ChemNet > CAS > 465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile
465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile
상품명칭 |
4-[2-(3-methoxyphenyl)acetyl]benzonitrile |
별명 |
4-[(3-methoxyphenyl)acetyl]benzonitrile |
분자식 |
C16H13NO2 |
분자량 |
251.2799 |
InChI |
InChI=1/C16H13NO2/c1-19-15-4-2-3-13(9-15)10-16(18)14-7-5-12(11-17)6-8-14/h2-9H,10H2,1H3 |
cas번호 |
465514-67-4 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
녹는 점 |
113.9℃ |
비등점 |
445.6°C at 760 mmHg |
굴절 지수 |
1.592 |
인화점 |
194.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|